C19H29NO7S — CID 87366575
[(1R)-1-phenylethyl] (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate (PubChem CID 87366575) has the molecular formula C19H29NO7S and a molecular weight of 415.51 g/mol. Its IUPAC name is [(1R)-1-phenylethyl] (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate.
| Compound Name | [(1R)-1-phenylethyl] (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 87366575 |
| Molecular Formula | C19H29NO7S |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | [(1R)-1-phenylethyl] (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
| SMILES | CC(=O)NCCCS(=O)(=O)OCC(C)(C)[C@@H](O)C(=O)O[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C19H29NO7S/c1-14(16-9-6-5-7-10-16)27-18(23)17(22)19(3,4)13-26-28(24,25)12-8-11-20-15(2)21/h5-7,9-10,14,17,22H,8,11-13H2,1-4H3,(H,20,21)/t14-,17+/m1/s1 |
| InChIKey | GTBHYTYMGDSKNM-PBHICJAKSA-N |
| XLogP | 1.55 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|