C20H35NO10S — CID 25225547
2-cyclohexyloxycarbonyloxyethyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate (PubChem CID 25225547) has the molecular formula C20H35NO10S and a molecular weight of 481.56 g/mol. Its IUPAC name is 2-cyclohexyloxycarbonyloxyethyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate.
| Compound Name | 2-cyclohexyloxycarbonyloxyethyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 25225547 |
| Molecular Formula | C20H35NO10S |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 2-cyclohexyloxycarbonyloxyethyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
| SMILES | CC(=O)NCCCS(=O)(=O)OCC(C)(C)[C@@H](O)C(=O)OCCOC(=O)OC1CCCCC1 |
| InChI | InChI=1S/C20H35NO10S/c1-15(22)21-10-7-13-32(26,27)30-14-20(2,3)17(23)18(24)28-11-12-29-19(25)31-16-8-5-4-6-9-16/h16-17,23H,4-14H2,1-3H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | BEIKUZDBTYZISH-KRWDZBQOSA-N |
| XLogP | 1.28 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|