C20H36NO12PS — CID 54755151
2-[(2R)-4-(3-acetamidopropylsulfonyloxy)-3,3-dimethyl-2-phosphonooxybutanoyl]oxyethyl cyclohexanecarboxylate (PubChem CID 54755151) has the molecular formula C20H36NO12PS and a molecular weight of 545.54 g/mol. Its IUPAC name is 2-[(2R)-4-(3-acetamidopropylsulfonyloxy)-3,3-dimethyl-2-phosphonooxybutanoyl]oxyethyl cyclohexanecarboxylate.
| Compound Name | 2-[(2R)-4-(3-acetamidopropylsulfonyloxy)-3,3-dimethyl-2-phosphonooxybutanoyl]oxyethyl cyclohexanecarboxylate |
|---|---|
| PubChem CID | 54755151 |
| Molecular Formula | C20H36NO12PS |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 545.17 |
| IUPAC Name | 2-[(2R)-4-(3-acetamidopropylsulfonyloxy)-3,3-dimethyl-2-phosphonooxybutanoyl]oxyethyl cyclohexanecarboxylate |
| SMILES | CC(=O)NCCCS(=O)(=O)OCC(C)(C)[C@@H](OP(=O)(O)O)C(=O)OCCOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C20H36NO12PS/c1-15(22)21-10-7-13-35(28,29)32-14-20(2,3)17(33-34(25,26)27)19(24)31-12-11-30-18(23)16-8-5-4-6-9-16/h16-17H,4-14H2,1-3H3,(H,21,22)(H2,25,26,27)/t17-/m0/s1 |
| InChIKey | YJSYOPGPGLYHTA-KRWDZBQOSA-N |
| XLogP | 1.03 |
| TPSA | 191.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|