About (4-amino-2,2-dimethylbutyl) 3-acetamidopropane-1-sulfonate;hydrochloride
(4-amino-2,2-dimethylbutyl) 3-acetamidopropane-1-sulfonate;hydrochloride (PubChem CID 25216533) has the molecular formula C11H25ClN2O4S
and a molecular weight of 316.85 g/mol. Its IUPAC name is (4-amino-2,2-dimethylbutyl) 3-acetamidopropane-1-sulfonate;hydrochloride.
Molecular Properties
| Compound Name | (4-amino-2,2-dimethylbutyl) 3-acetamidopropane-1-sulfonate;hydrochloride |
| PubChem CID | 25216533 |
| Molecular Formula | C11H25ClN2O4S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | (4-amino-2,2-dimethylbutyl) 3-acetamidopropane-1-sulfonate;hydrochloride |
| SMILES | CC(=O)NCCCS(=O)(=O)OCC(C)(C)CCN.Cl |
| InChI | InChI=1S/C11H24N2O4S.ClH/c1-10(14)13-7-4-8-18(15,16)17-9-11(2,3)5-6-12;/h4-9,12H2,1-3H3,(H,13,14);1H |
| InChIKey | SDJXMDCDISHYTF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (4-amino-2,2-dimethylbutyl) 3-acetamidopropane-1-sulfonate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-amino-2,2-dimethylbutyl) 3-acetamidopropane-1-sulfonate;hydrochloride?
The IUPAC name of (4-amino-2,2-dimethylbutyl) 3-acetamidopropane-1-sulfonate;hydrochloride (CID 25216533) is (4-amino-2,2-dimethylbutyl) 3-acetamidopropane-1-sulfonate;hydrochloride.
What is the SMILES notation for (4-amino-2,2-dimethylbutyl) 3-acetamidopropane-1-sulfonate;hydrochloride?
The canonical SMILES for (4-amino-2,2-dimethylbutyl) 3-acetamidopropane-1-sulfonate;hydrochloride is CC(=O)NCCCS(=O)(=O)OCC(C)(C)CCN.Cl.
What is the InChIKey of (4-amino-2,2-dimethylbutyl) 3-acetamidopropane-1-sulfonate;hydrochloride?
The InChIKey is SDJXMDCDISHYTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2O4S.ClH/c1-10(14)13-7-4-8-18(15,16)17-9-11(2,3)5-6-12;/h4-9,12H2,1-3H3,(H,13,14);1H.
What are the key properties of (4-amino-2,2-dimethylbutyl) 3-acetamidopropane-1-sulfonate;hydrochloride?
(4-amino-2,2-dimethylbutyl) 3-acetamidopropane-1-sulfonate;hydrochloride has a molecular weight of 316.85 g/mol, XLogP of 0.66, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-amino-2,2-dimethylbutyl) 3-acetamidopropane-1-sulfonate;hydrochloride is sourced from PubChem (CID 25216533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).