C17H31NO9S — CID 74407749
2-(2-methylpropanoyloxy)ethyl 4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate (PubChem CID 74407749) has the molecular formula C17H31NO9S and a molecular weight of 425.50 g/mol. Its IUPAC name is 2-(2-methylpropanoyloxy)ethyl 4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate.
| Compound Name | 2-(2-methylpropanoyloxy)ethyl 4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 74407749 |
| Molecular Formula | C17H31NO9S |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 2-(2-methylpropanoyloxy)ethyl 4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
| SMILES | CC(=O)NCCCS(=O)(=O)OCC(C)(C)C(O)C(=O)OCCOC(=O)C(C)C |
| InChI | InChI=1S/C17H31NO9S/c1-12(2)15(21)25-8-9-26-16(22)14(20)17(4,5)11-27-28(23,24)10-6-7-18-13(3)19/h12,14,20H,6-11H2,1-5H3,(H,18,19) |
| InChIKey | LUDWHXUKAFAOMJ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|