C14H25NO10S — CID 87423442
methoxycarbonyloxymethyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate (PubChem CID 87423442) has the molecular formula C14H25NO10S and a molecular weight of 399.42 g/mol. Its IUPAC name is methoxycarbonyloxymethyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate.
| Compound Name | methoxycarbonyloxymethyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 87423442 |
| Molecular Formula | C14H25NO10S |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | methoxycarbonyloxymethyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
| SMILES | COC(=O)OCOC(=O)[C@H](O)C(C)(C)COS(=O)(=O)CCCNC(C)=O |
| InChI | InChI=1S/C14H25NO10S/c1-10(16)15-6-5-7-26(20,21)25-8-14(2,3)11(17)12(18)23-9-24-13(19)22-4/h11,17H,5-9H2,1-4H3,(H,15,16)/t11-/m0/s1 |
| InChIKey | WPHWZGCQQKXICH-NSHDSACASA-N |
| XLogP | -0.47 |
| TPSA | 154.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|