C17H31NO9S — CID 87423807
4-acetyloxybutyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate (PubChem CID 87423807) has the molecular formula C17H31NO9S and a molecular weight of 425.50 g/mol. Its IUPAC name is 4-acetyloxybutyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate.
| Compound Name | 4-acetyloxybutyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 87423807 |
| Molecular Formula | C17H31NO9S |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 4-acetyloxybutyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
| SMILES | CC(=O)NCCCS(=O)(=O)OCC(C)(C)[C@@H](O)C(=O)OCCCCOC(C)=O |
| InChI | InChI=1S/C17H31NO9S/c1-13(19)18-8-7-11-28(23,24)27-12-17(3,4)15(21)16(22)26-10-6-5-9-25-14(2)20/h15,21H,5-12H2,1-4H3,(H,18,19)/t15-/m0/s1 |
| InChIKey | ANLTZQGRLRSZLL-HNNXBMFYSA-N |
| XLogP | 0.13 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|