C18H33NO10S — CID 25225926
2-(3-hydroxy-2,2-dimethylpropanoyl)oxyethyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate (PubChem CID 25225926) has the molecular formula C18H33NO10S and a molecular weight of 455.53 g/mol. Its IUPAC name is 2-(3-hydroxy-2,2-dimethylpropanoyl)oxyethyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate.
| Compound Name | 2-(3-hydroxy-2,2-dimethylpropanoyl)oxyethyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 25225926 |
| Molecular Formula | C18H33NO10S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | 2-(3-hydroxy-2,2-dimethylpropanoyl)oxyethyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
| SMILES | CC(=O)NCCCS(=O)(=O)OCC(C)(C)[C@@H](O)C(=O)OCCOC(=O)C(C)(C)CO |
| InChI | InChI=1S/C18H33NO10S/c1-13(21)19-7-6-10-30(25,26)29-12-18(4,5)14(22)15(23)27-8-9-28-16(24)17(2,3)11-20/h14,20,22H,6-12H2,1-5H3,(H,19,21)/t14-/m0/s1 |
| InChIKey | NKBLWHISRCOESW-AWEZNQCLSA-N |
| XLogP | -0.65 |
| TPSA | 165.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|