C18H33NO9S — CID 87423219
1-(2-methylpropanoyloxy)propyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate (PubChem CID 87423219) has the molecular formula C18H33NO9S and a molecular weight of 439.53 g/mol. Its IUPAC name is 1-(2-methylpropanoyloxy)propyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate.
| Compound Name | 1-(2-methylpropanoyloxy)propyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 87423219 |
| Molecular Formula | C18H33NO9S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 1-(2-methylpropanoyloxy)propyl (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
| SMILES | CCC(OC(=O)C(C)C)OC(=O)[C@H](O)C(C)(C)COS(=O)(=O)CCCNC(C)=O |
| InChI | InChI=1S/C18H33NO9S/c1-7-14(27-16(22)12(2)3)28-17(23)15(21)18(5,6)11-26-29(24,25)10-8-9-19-13(4)20/h12,14-15,21H,7-11H2,1-6H3,(H,19,20)/t14?,15-/m0/s1 |
| InChIKey | XGLILHNGRIMVOI-LOACHALJSA-N |
| XLogP | 0.72 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|