C23H35NO9S — CID 87423248
[pentanoyloxy(phenyl)methyl] (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate (PubChem CID 87423248) has the molecular formula C23H35NO9S and a molecular weight of 501.60 g/mol. Its IUPAC name is [pentanoyloxy(phenyl)methyl] (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate.
| Compound Name | [pentanoyloxy(phenyl)methyl] (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 87423248 |
| Molecular Formula | C23H35NO9S |
| Molecular Weight | 501.60 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | [pentanoyloxy(phenyl)methyl] (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoate |
| SMILES | CCCCC(=O)OC(OC(=O)[C@H](O)C(C)(C)COS(=O)(=O)CCCNC(C)=O)c1ccccc1 |
| InChI | InChI=1S/C23H35NO9S/c1-5-6-13-19(26)32-22(18-11-8-7-9-12-18)33-21(28)20(27)23(3,4)16-31-34(29,30)15-10-14-24-17(2)25/h7-9,11-12,20,22,27H,5-6,10,13-16H2,1-4H3,(H,24,25)/t20-,22?/m0/s1 |
| InChIKey | ZBSAMZYHQCLWOF-AIBWNMTMSA-N |
| XLogP | 2.22 |
| TPSA | 145.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.60 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|