C13H26N2O6S — CID 25216664
[4-(3-acetamidopropylsulfonyloxy)-3,3-dimethylbutyl] 2-aminoacetate (PubChem CID 25216664) has the molecular formula C13H26N2O6S and a molecular weight of 338.43 g/mol. Its IUPAC name is [4-(3-acetamidopropylsulfonyloxy)-3,3-dimethylbutyl] 2-aminoacetate.
| Compound Name | [4-(3-acetamidopropylsulfonyloxy)-3,3-dimethylbutyl] 2-aminoacetate |
|---|---|
| PubChem CID | 25216664 |
| Molecular Formula | C13H26N2O6S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | [4-(3-acetamidopropylsulfonyloxy)-3,3-dimethylbutyl] 2-aminoacetate |
| SMILES | CC(=O)NCCCS(=O)(=O)OCC(C)(C)CCOC(=O)CN |
| InChI | InChI=1S/C13H26N2O6S/c1-11(16)15-6-4-8-22(18,19)21-10-13(2,3)5-7-20-12(17)9-14/h4-10,14H2,1-3H3,(H,15,16) |
| InChIKey | XMQIOHUUUZAPAI-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|