C20H35NO13P2S+2 — CID 25225929
[(2R)-4-(3-acetamidopropylsulfonyloxy)-1-[2-(cyclohexanecarbonyloxy)ethoxy]-3,3-dimethyl-1-oxobutan-2-yl]oxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium (PubChem CID 25225929) has the molecular formula C20H35NO13P2S+2 and a molecular weight of 591.51 g/mol. Its IUPAC name is [(2R)-4-(3-acetamidopropylsulfonyloxy)-1-[2-(cyclohexanecarbonyloxy)ethoxy]-3,3-dimethyl-1-oxobutan-2-yl]oxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium.
| Compound Name | [(2R)-4-(3-acetamidopropylsulfonyloxy)-1-[2-(cyclohexanecarbonyloxy)ethoxy]-3,3-dimethyl-1-oxobutan-2-yl]oxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium |
|---|---|
| PubChem CID | 25225929 |
| Molecular Formula | C20H35NO13P2S+2 |
| Molecular Weight | 591.51 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | [(2R)-4-(3-acetamidopropylsulfonyloxy)-1-[2-(cyclohexanecarbonyloxy)ethoxy]-3,3-dimethyl-1-oxobutan-2-yl]oxy-[hydroxy(oxo)phosphaniumyl]oxy-oxophosphanium |
| SMILES | CC(=O)NCCCS(=O)(=O)OCC(C)(C)[C@@H](O[P+](=O)O[P+](=O)O)C(=O)OCCOC(=O)C1CCCCC1 |
| InChI | InChI=1S/C20H33NO13P2S/c1-15(22)21-10-7-13-37(28,29)32-14-20(2,3)17(33-36(27)34-35(25)26)19(24)31-12-11-30-18(23)16-8-5-4-6-9-16/h16-17H,4-14H2,1-3H3/p+2/t17-/m0/s1 |
| InChIKey | NKLGEWVKBDLUDE-KRWDZBQOSA-P |
| XLogP | 2.26 |
| TPSA | 197.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.51 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|