C23H45NO9SSi — CID 90794526
[(2S)-1-oxo-1-propan-2-yloxypropan-2-yl] (2R)-4-(3-acetamidopropylsulfonyloxy)-2-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanoate (PubChem CID 90794526) has the molecular formula C23H45NO9SSi and a molecular weight of 539.76 g/mol. Its IUPAC name is [(2S)-1-oxo-1-propan-2-yloxypropan-2-yl] (2R)-4-(3-acetamidopropylsulfonyloxy)-2-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanoate.
| Compound Name | [(2S)-1-oxo-1-propan-2-yloxypropan-2-yl] (2R)-4-(3-acetamidopropylsulfonyloxy)-2-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 90794526 |
| Molecular Formula | C23H45NO9SSi |
| Molecular Weight | 539.76 g/mol |
| Exact Mass | 539.26 |
| IUPAC Name | [(2S)-1-oxo-1-propan-2-yloxypropan-2-yl] (2R)-4-(3-acetamidopropylsulfonyloxy)-2-[tert-butyl(dimethyl)silyl]oxy-3,3-dimethylbutanoate |
| SMILES | CC(=O)NCCCS(=O)(=O)OCC(C)(C)[C@@H](O[Si](C)(C)C(C)(C)C)C(=O)O[C@@H](C)C(=O)OC(C)C |
| InChI | InChI=1S/C23H45NO9SSi/c1-16(2)31-20(26)17(3)32-21(27)19(33-35(10,11)22(5,6)7)23(8,9)15-30-34(28,29)14-12-13-24-18(4)25/h16-17,19H,12-15H2,1-11H3,(H,24,25)/t17-,19-/m0/s1 |
| InChIKey | ZIGOACOPAMEGKO-HKUYNNGSSA-N |
| XLogP | 3.16 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.76 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|