C17H31NO10S — CID 87423917
(2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethyl-2-(2-methylpropoxycarbonyloxymethyl)butanoic acid (PubChem CID 87423917) has the molecular formula C17H31NO10S and a molecular weight of 441.50 g/mol. Its IUPAC name is (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethyl-2-(2-methylpropoxycarbonyloxymethyl)butanoic acid.
| Compound Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethyl-2-(2-methylpropoxycarbonyloxymethyl)butanoic acid |
|---|---|
| PubChem CID | 87423917 |
| Molecular Formula | C17H31NO10S |
| Molecular Weight | 441.50 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethyl-2-(2-methylpropoxycarbonyloxymethyl)butanoic acid |
| SMILES | CC(=O)NCCCS(=O)(=O)OCC(C)(C)[C@@](O)(COC(=O)OCC(C)C)C(=O)O |
| InChI | InChI=1S/C17H31NO10S/c1-12(2)9-26-15(22)27-11-17(23,14(20)21)16(4,5)10-28-29(24,25)8-6-7-18-13(3)19/h12,23H,6-11H2,1-5H3,(H,18,19)(H,20,21)/t17-/m1/s1 |
| InChIKey | JWDNFZKRQYQCSA-QGZVFWFLSA-N |
| XLogP | 0.51 |
| TPSA | 165.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.50 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|