C19H28N2O9S — CID 87423454
(2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethyl-2-[2-(pyridine-3-carbonyloxy)ethyl]butanoic acid (PubChem CID 87423454) has the molecular formula C19H28N2O9S and a molecular weight of 460.51 g/mol. Its IUPAC name is (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethyl-2-[2-(pyridine-3-carbonyloxy)ethyl]butanoic acid.
| Compound Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethyl-2-[2-(pyridine-3-carbonyloxy)ethyl]butanoic acid |
|---|---|
| PubChem CID | 87423454 |
| Molecular Formula | C19H28N2O9S |
| Molecular Weight | 460.51 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethyl-2-[2-(pyridine-3-carbonyloxy)ethyl]butanoic acid |
| SMILES | CC(=O)NCCCS(=O)(=O)OCC(C)(C)[C@](O)(CCOC(=O)c1cccnc1)C(=O)O |
| InChI | InChI=1S/C19H28N2O9S/c1-14(22)21-9-5-11-31(27,28)30-13-18(2,3)19(26,17(24)25)7-10-29-16(23)15-6-4-8-20-12-15/h4,6,8,12,26H,5,7,9-11,13H2,1-3H3,(H,21,22)(H,24,25)/t19-/m0/s1 |
| InChIKey | CIXCJOUQIUTTQP-IBGZPJMESA-N |
| XLogP | 0.34 |
| TPSA | 169.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.51 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|