C24H36N2O9S — CID 87423086
[(2R)-4-(3-acetamidopropylsulfonyloxy)-2-cyclohexyl-2-hydroxy-3,3-dimethylbutanoyl]oxymethyl pyridine-3-carboxylate (PubChem CID 87423086) has the molecular formula C24H36N2O9S and a molecular weight of 528.62 g/mol. Its IUPAC name is [(2R)-4-(3-acetamidopropylsulfonyloxy)-2-cyclohexyl-2-hydroxy-3,3-dimethylbutanoyl]oxymethyl pyridine-3-carboxylate.
| Compound Name | [(2R)-4-(3-acetamidopropylsulfonyloxy)-2-cyclohexyl-2-hydroxy-3,3-dimethylbutanoyl]oxymethyl pyridine-3-carboxylate |
|---|---|
| PubChem CID | 87423086 |
| Molecular Formula | C24H36N2O9S |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | [(2R)-4-(3-acetamidopropylsulfonyloxy)-2-cyclohexyl-2-hydroxy-3,3-dimethylbutanoyl]oxymethyl pyridine-3-carboxylate |
| SMILES | CC(=O)NCCCS(=O)(=O)OCC(C)(C)[C@@](O)(C(=O)OCOC(=O)c1cccnc1)C1CCCCC1 |
| InChI | InChI=1S/C24H36N2O9S/c1-18(27)26-13-8-14-36(31,32)35-16-23(2,3)24(30,20-10-5-4-6-11-20)22(29)34-17-33-21(28)19-9-7-12-25-15-19/h7,9,12,15,20,30H,4-6,8,10-11,13-14,16-17H2,1-3H3,(H,26,27)/t24-/m0/s1 |
| InChIKey | AZRHOZAITZPOHU-DEOSSOPVSA-N |
| XLogP | 1.95 |
| TPSA | 158.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|