C11H21NO7S — CID 123977621
2-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoic acid (PubChem CID 123977621) has the molecular formula C11H21NO7S and a molecular weight of 311.36 g/mol. Its IUPAC name is 2-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoic acid.
| Compound Name | 2-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 123977621 |
| Molecular Formula | C11H21NO7S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 2-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3-dimethylbutanoic acid |
| SMILES | CC(=O)NCCCS(=O)(=O)OC(O)(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C11H21NO7S/c1-8(13)12-6-5-7-20(17,18)19-11(16,9(14)15)10(2,3)4/h16H,5-7H2,1-4H3,(H,12,13)(H,14,15) |
| InChIKey | JBPKRERPDYKEFF-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|