C14H27NO7S — CID 87365972
(2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3,5-trimethylhexanoic acid (PubChem CID 87365972) has the molecular formula C14H27NO7S and a molecular weight of 353.44 g/mol. Its IUPAC name is (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3,5-trimethylhexanoic acid.
| Compound Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3,5-trimethylhexanoic acid |
|---|---|
| PubChem CID | 87365972 |
| Molecular Formula | C14H27NO7S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-2-hydroxy-3,3,5-trimethylhexanoic acid |
| SMILES | CC(=O)NCCCS(=O)(=O)OC(C(C)C)C(C)(C)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C14H27NO7S/c1-9(2)12(14(4,5)11(17)13(18)19)22-23(20,21)8-6-7-15-10(3)16/h9,11-12,17H,6-8H2,1-5H3,(H,15,16)(H,18,19)/t11-,12?/m0/s1 |
| InChIKey | GIMPOGIWRQPGPB-PXYINDEMSA-N |
| XLogP | 0.36 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|