C14H25NO9S — CID 87423149
(2R)-4-(3-acetamidopropylsulfonyloxy)-5-acetyloxy-2-hydroxy-3,3-dimethylpentanoic acid (PubChem CID 87423149) has the molecular formula C14H25NO9S and a molecular weight of 383.42 g/mol. Its IUPAC name is (2R)-4-(3-acetamidopropylsulfonyloxy)-5-acetyloxy-2-hydroxy-3,3-dimethylpentanoic acid.
| Compound Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-5-acetyloxy-2-hydroxy-3,3-dimethylpentanoic acid |
|---|---|
| PubChem CID | 87423149 |
| Molecular Formula | C14H25NO9S |
| Molecular Weight | 383.42 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-5-acetyloxy-2-hydroxy-3,3-dimethylpentanoic acid |
| SMILES | CC(=O)NCCCS(=O)(=O)OC(COC(C)=O)C(C)(C)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C14H25NO9S/c1-9(16)15-6-5-7-25(21,22)24-11(8-23-10(2)17)14(3,4)12(18)13(19)20/h11-12,18H,5-8H2,1-4H3,(H,15,16)(H,19,20)/t11?,12-/m0/s1 |
| InChIKey | OFEKAQCTLSOTEG-KIYNQFGBSA-N |
| XLogP | -0.74 |
| TPSA | 156.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.42 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|