C20H37NO9S — CID 87422987
(2R)-4-(3-acetamidopropylsulfonyloxy)-8-(2,2-dimethylpropanoyloxy)-2-hydroxy-3,3-dimethyloctanoic acid (PubChem CID 87422987) has the molecular formula C20H37NO9S and a molecular weight of 467.58 g/mol. Its IUPAC name is (2R)-4-(3-acetamidopropylsulfonyloxy)-8-(2,2-dimethylpropanoyloxy)-2-hydroxy-3,3-dimethyloctanoic acid.
| Compound Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-8-(2,2-dimethylpropanoyloxy)-2-hydroxy-3,3-dimethyloctanoic acid |
|---|---|
| PubChem CID | 87422987 |
| Molecular Formula | C20H37NO9S |
| Molecular Weight | 467.58 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-8-(2,2-dimethylpropanoyloxy)-2-hydroxy-3,3-dimethyloctanoic acid |
| SMILES | CC(=O)NCCCS(=O)(=O)OC(CCCCOC(=O)C(C)(C)C)C(C)(C)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C20H37NO9S/c1-14(22)21-11-9-13-31(27,28)30-15(20(5,6)16(23)17(24)25)10-7-8-12-29-18(26)19(2,3)4/h15-16,23H,7-13H2,1-6H3,(H,21,22)(H,24,25)/t15?,16-/m0/s1 |
| InChIKey | JNELJZJJTNAYNW-LYKKTTPLSA-N |
| XLogP | 1.46 |
| TPSA | 156.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.58 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|