C18H33NO10S — CID 87423846
(2R)-4-(3-acetamidopropylsulfonyloxy)-5-ethoxycarbonyloxy-2-hydroxy-3,3,6-trimethylheptanoic acid (PubChem CID 87423846) has the molecular formula C18H33NO10S and a molecular weight of 455.53 g/mol. Its IUPAC name is (2R)-4-(3-acetamidopropylsulfonyloxy)-5-ethoxycarbonyloxy-2-hydroxy-3,3,6-trimethylheptanoic acid.
| Compound Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-5-ethoxycarbonyloxy-2-hydroxy-3,3,6-trimethylheptanoic acid |
|---|---|
| PubChem CID | 87423846 |
| Molecular Formula | C18H33NO10S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-5-ethoxycarbonyloxy-2-hydroxy-3,3,6-trimethylheptanoic acid |
| SMILES | CCOC(=O)OC(C(C)C)C(OS(=O)(=O)CCCNC(C)=O)C(C)(C)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C18H33NO10S/c1-7-27-17(24)28-13(11(2)3)15(18(5,6)14(21)16(22)23)29-30(25,26)10-8-9-19-12(4)20/h11,13-15,21H,7-10H2,1-6H3,(H,19,20)(H,22,23)/t13?,14-,15?/m0/s1 |
| InChIKey | JWDWUIVWRBNDAM-SLTAFYQDSA-N |
| XLogP | 0.90 |
| TPSA | 165.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|