C17H30N2O9S — CID 87365194
(2R)-4-(3-acetamidopropylsulfonyloxy)-2-acetyloxy-6-(dimethylamino)-3,3-dimethyl-6-oxohexanoic acid (PubChem CID 87365194) has the molecular formula C17H30N2O9S and a molecular weight of 438.50 g/mol. Its IUPAC name is (2R)-4-(3-acetamidopropylsulfonyloxy)-2-acetyloxy-6-(dimethylamino)-3,3-dimethyl-6-oxohexanoic acid.
| Compound Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-2-acetyloxy-6-(dimethylamino)-3,3-dimethyl-6-oxohexanoic acid |
|---|---|
| PubChem CID | 87365194 |
| Molecular Formula | C17H30N2O9S |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-2-acetyloxy-6-(dimethylamino)-3,3-dimethyl-6-oxohexanoic acid |
| SMILES | CC(=O)NCCCS(=O)(=O)OC(CC(=O)N(C)C)C(C)(C)[C@@H](OC(C)=O)C(=O)O |
| InChI | InChI=1S/C17H30N2O9S/c1-11(20)18-8-7-9-29(25,26)28-13(10-14(22)19(5)6)17(3,4)15(16(23)24)27-12(2)21/h13,15H,7-10H2,1-6H3,(H,18,20)(H,23,24)/t13?,15-/m0/s1 |
| InChIKey | JNHIEXLJCULLQQ-WUJWULDRSA-N |
| XLogP | -0.25 |
| TPSA | 156.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|