C10H20N2O6S — CID 140533565
methyl 4-(3-acetamidopropylsulfonyloxy)-4-aminobutanoate (PubChem CID 140533565) has the molecular formula C10H20N2O6S and a molecular weight of 296.34 g/mol. Its IUPAC name is methyl 4-(3-acetamidopropylsulfonyloxy)-4-aminobutanoate.
| Compound Name | methyl 4-(3-acetamidopropylsulfonyloxy)-4-aminobutanoate |
|---|---|
| PubChem CID | 140533565 |
| Molecular Formula | C10H20N2O6S |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | methyl 4-(3-acetamidopropylsulfonyloxy)-4-aminobutanoate |
| SMILES | COC(=O)CCC(N)OS(=O)(=O)CCCNC(C)=O |
| InChI | InChI=1S/C10H20N2O6S/c1-8(13)12-6-3-7-19(15,16)18-9(11)4-5-10(14)17-2/h9H,3-7,11H2,1-2H3,(H,12,13) |
| InChIKey | SNGYNWJITZQDGK-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 124.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|