C16H29NO10S — CID 87423020
(2R)-4-(3-acetamidopropylsulfonyloxy)-6-ethoxycarbonyloxy-2-hydroxy-3,3-dimethylhexanoic acid (PubChem CID 87423020) has the molecular formula C16H29NO10S and a molecular weight of 427.47 g/mol. Its IUPAC name is (2R)-4-(3-acetamidopropylsulfonyloxy)-6-ethoxycarbonyloxy-2-hydroxy-3,3-dimethylhexanoic acid.
| Compound Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-6-ethoxycarbonyloxy-2-hydroxy-3,3-dimethylhexanoic acid |
|---|---|
| PubChem CID | 87423020 |
| Molecular Formula | C16H29NO10S |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-6-ethoxycarbonyloxy-2-hydroxy-3,3-dimethylhexanoic acid |
| SMILES | CCOC(=O)OCCC(OS(=O)(=O)CCCNC(C)=O)C(C)(C)[C@@H](O)C(=O)O |
| InChI | InChI=1S/C16H29NO10S/c1-5-25-15(22)26-9-7-12(16(3,4)13(19)14(20)21)27-28(23,24)10-6-8-17-11(2)18/h12-13,19H,5-10H2,1-4H3,(H,17,18)(H,20,21)/t12?,13-/m0/s1 |
| InChIKey | HMTLLMCMTJDOQY-ABLWVSNPSA-N |
| XLogP | 0.26 |
| TPSA | 165.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|