C23H41NO9S — CID 87423818
(2R)-4-(3-acetamidopropylsulfonyloxy)-2-(cyclohexylmethyl)-4-(2,2-dimethylpropanoyloxy)-2-hydroxy-3,3-dimethylbutanoic acid (PubChem CID 87423818) has the molecular formula C23H41NO9S and a molecular weight of 507.65 g/mol. Its IUPAC name is (2R)-4-(3-acetamidopropylsulfonyloxy)-2-(cyclohexylmethyl)-4-(2,2-dimethylpropanoyloxy)-2-hydroxy-3,3-dimethylbutanoic acid.
| Compound Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-2-(cyclohexylmethyl)-4-(2,2-dimethylpropanoyloxy)-2-hydroxy-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 87423818 |
| Molecular Formula | C23H41NO9S |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.25 |
| IUPAC Name | (2R)-4-(3-acetamidopropylsulfonyloxy)-2-(cyclohexylmethyl)-4-(2,2-dimethylpropanoyloxy)-2-hydroxy-3,3-dimethylbutanoic acid |
| SMILES | CC(=O)NCCCS(=O)(=O)OC(OC(=O)C(C)(C)C)C(C)(C)[C@](O)(CC1CCCCC1)C(=O)O |
| InChI | InChI=1S/C23H41NO9S/c1-16(25)24-13-10-14-34(30,31)33-20(32-19(28)21(2,3)4)22(5,6)23(29,18(26)27)15-17-11-8-7-9-12-17/h17,20,29H,7-15H2,1-6H3,(H,24,25)(H,26,27)/t20?,23-/m0/s1 |
| InChIKey | VPJRJUJWAWRJQA-AKRCKQFNSA-N |
| XLogP | 2.59 |
| TPSA | 156.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|