C12H21NO7S — CID 74816790
[2-methyl-2-(2-oxo-1,3-dioxolan-4-yl)propyl] 3-acetamidopropane-1-sulfonate (PubChem CID 74816790) has the molecular formula C12H21NO7S and a molecular weight of 323.37 g/mol. Its IUPAC name is [2-methyl-2-(2-oxo-1,3-dioxolan-4-yl)propyl] 3-acetamidopropane-1-sulfonate.
| Compound Name | [2-methyl-2-(2-oxo-1,3-dioxolan-4-yl)propyl] 3-acetamidopropane-1-sulfonate |
|---|---|
| PubChem CID | 74816790 |
| Molecular Formula | C12H21NO7S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | [2-methyl-2-(2-oxo-1,3-dioxolan-4-yl)propyl] 3-acetamidopropane-1-sulfonate |
| SMILES | CC(=O)NCCCS(=O)(=O)OCC(C)(C)C1COC(=O)O1 |
| InChI | InChI=1S/C12H21NO7S/c1-9(14)13-5-4-6-21(16,17)19-8-12(2,3)10-7-18-11(15)20-10/h10H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | YAFYGIJHYGDVLN-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|