C16H24O9S2 — CID 88862860
3-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-phenylmethoxybutoxy]sulfonylpropane-1-sulfonic acid (PubChem CID 88862860) has the molecular formula C16H24O9S2 and a molecular weight of 424.49 g/mol. Its IUPAC name is 3-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-phenylmethoxybutoxy]sulfonylpropane-1-sulfonic acid.
| Compound Name | 3-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-phenylmethoxybutoxy]sulfonylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 88862860 |
| Molecular Formula | C16H24O9S2 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.09 |
| IUPAC Name | 3-[(3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-phenylmethoxybutoxy]sulfonylpropane-1-sulfonic acid |
| SMILES | CC(C)(COS(=O)(=O)CCCS(=O)(=O)O)[C@@H](O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C16H24O9S2/c1-16(2,12-25-27(22,23)10-6-9-26(19,20)21)14(17)15(18)24-11-13-7-4-3-5-8-13/h3-5,7-8,14,17H,6,9-12H2,1-2H3,(H,19,20,21)/t14-/m0/s1 |
| InChIKey | ZIYKPIVJDSGEBR-AWEZNQCLSA-N |
| XLogP | 0.74 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|