C17H34N2O10S2 — CID 123879019
4-[3-(4-amino-3-carboxy-2,2-dimethylbutoxy)sulfonylpropylsulfonyloxy]-2-(aminomethyl)-3,3-dimethylbutanoic acid (PubChem CID 123879019) has the molecular formula C17H34N2O10S2 and a molecular weight of 490.60 g/mol. Its IUPAC name is 4-[3-(4-amino-3-carboxy-2,2-dimethylbutoxy)sulfonylpropylsulfonyloxy]-2-(aminomethyl)-3,3-dimethylbutanoic acid.
| Compound Name | 4-[3-(4-amino-3-carboxy-2,2-dimethylbutoxy)sulfonylpropylsulfonyloxy]-2-(aminomethyl)-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 123879019 |
| Molecular Formula | C17H34N2O10S2 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 4-[3-(4-amino-3-carboxy-2,2-dimethylbutoxy)sulfonylpropylsulfonyloxy]-2-(aminomethyl)-3,3-dimethylbutanoic acid |
| SMILES | CC(C)(COS(=O)(=O)CCCS(=O)(=O)OCC(C)(C)C(CN)C(=O)O)C(CN)C(=O)O |
| InChI | InChI=1S/C17H34N2O10S2/c1-16(2,12(8-18)14(20)21)10-28-30(24,25)6-5-7-31(26,27)29-11-17(3,4)13(9-19)15(22)23/h12-13H,5-11,18-19H2,1-4H3,(H,20,21)(H,22,23) |
| InChIKey | ICFWSGMTMPBCFH-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 213.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|