C14H26O12S2 — CID 50938684
3-[(3S)-4-(1-ethoxycarbonyloxyethoxy)-3-hydroxy-2,2-dimethyl-4-oxobutoxy]sulfonylpropane-1-sulfonic acid (PubChem CID 50938684) has the molecular formula C14H26O12S2 and a molecular weight of 450.48 g/mol. Its IUPAC name is 3-[(3S)-4-(1-ethoxycarbonyloxyethoxy)-3-hydroxy-2,2-dimethyl-4-oxobutoxy]sulfonylpropane-1-sulfonic acid.
| Compound Name | 3-[(3S)-4-(1-ethoxycarbonyloxyethoxy)-3-hydroxy-2,2-dimethyl-4-oxobutoxy]sulfonylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 50938684 |
| Molecular Formula | C14H26O12S2 |
| Molecular Weight | 450.48 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | 3-[(3S)-4-(1-ethoxycarbonyloxyethoxy)-3-hydroxy-2,2-dimethyl-4-oxobutoxy]sulfonylpropane-1-sulfonic acid |
| SMILES | CCOC(=O)OC(C)OC(=O)[C@@H](O)C(C)(C)COS(=O)(=O)CCCS(=O)(=O)O |
| InChI | InChI=1S/C14H26O12S2/c1-5-23-13(17)26-10(2)25-12(16)11(15)14(3,4)9-24-28(21,22)8-6-7-27(18,19)20/h10-11,15H,5-9H2,1-4H3,(H,18,19,20)/t10?,11-/m1/s1 |
| InChIKey | MEAKUIZUMXYGID-RRKGBCIJSA-N |
| XLogP | 0.06 |
| TPSA | 179.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.48 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|