C11H22O9S2 — CID 88862865
3-[(3R)-4-ethoxy-3-hydroxy-2,2-dimethyl-4-oxobutoxy]sulfonylpropane-1-sulfonic acid (PubChem CID 88862865) has the molecular formula C11H22O9S2 and a molecular weight of 362.42 g/mol. Its IUPAC name is 3-[(3R)-4-ethoxy-3-hydroxy-2,2-dimethyl-4-oxobutoxy]sulfonylpropane-1-sulfonic acid.
| Compound Name | 3-[(3R)-4-ethoxy-3-hydroxy-2,2-dimethyl-4-oxobutoxy]sulfonylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 88862865 |
| Molecular Formula | C11H22O9S2 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | 3-[(3R)-4-ethoxy-3-hydroxy-2,2-dimethyl-4-oxobutoxy]sulfonylpropane-1-sulfonic acid |
| SMILES | CCOC(=O)[C@H](O)C(C)(C)COS(=O)(=O)CCCS(=O)(=O)O |
| InChI | InChI=1S/C11H22O9S2/c1-4-19-10(13)9(12)11(2,3)8-20-22(17,18)7-5-6-21(14,15)16/h9,12H,4-8H2,1-3H3,(H,14,15,16)/t9-/m0/s1 |
| InChIKey | MQTFPLNHNMCFFM-VIFPVBQESA-N |
| XLogP | -0.44 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|