C24H32O9S2 — CID 87207574
(2R)-3,3-dimethyl-4-(3-phenoxysulfonylpropylsulfonyloxy)-2-(1-phenylpropoxy)butanoic acid (PubChem CID 87207574) has the molecular formula C24H32O9S2 and a molecular weight of 528.65 g/mol. Its IUPAC name is (2R)-3,3-dimethyl-4-(3-phenoxysulfonylpropylsulfonyloxy)-2-(1-phenylpropoxy)butanoic acid.
| Compound Name | (2R)-3,3-dimethyl-4-(3-phenoxysulfonylpropylsulfonyloxy)-2-(1-phenylpropoxy)butanoic acid |
|---|---|
| PubChem CID | 87207574 |
| Molecular Formula | C24H32O9S2 |
| Molecular Weight | 528.65 g/mol |
| Exact Mass | 528.15 |
| IUPAC Name | (2R)-3,3-dimethyl-4-(3-phenoxysulfonylpropylsulfonyloxy)-2-(1-phenylpropoxy)butanoic acid |
| SMILES | CCC(O[C@@H](C(=O)O)C(C)(C)COS(=O)(=O)CCCS(=O)(=O)Oc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32O9S2/c1-4-21(19-12-7-5-8-13-19)32-22(23(25)26)24(2,3)18-31-34(27,28)16-11-17-35(29,30)33-20-14-9-6-10-15-20/h5-10,12-15,21-22H,4,11,16-18H2,1-3H3,(H,25,26)/t21?,22-/m0/s1 |
| InChIKey | DVMMUIMEZIGOSV-KEKNWZKVSA-N |
| XLogP | 3.78 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.65 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|