C17H25ClO6S — CID 87365726
(2R)-4-(3-chloropropylsulfonyloxy)-2,3,3-trimethyl-2-phenylmethoxybutanoic acid (PubChem CID 87365726) has the molecular formula C17H25ClO6S and a molecular weight of 392.90 g/mol. Its IUPAC name is (2R)-4-(3-chloropropylsulfonyloxy)-2,3,3-trimethyl-2-phenylmethoxybutanoic acid.
| Compound Name | (2R)-4-(3-chloropropylsulfonyloxy)-2,3,3-trimethyl-2-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 87365726 |
| Molecular Formula | C17H25ClO6S |
| Molecular Weight | 392.90 g/mol |
| Exact Mass | 392.11 |
| IUPAC Name | (2R)-4-(3-chloropropylsulfonyloxy)-2,3,3-trimethyl-2-phenylmethoxybutanoic acid |
| SMILES | CC(C)(COS(=O)(=O)CCCCl)[C@@](C)(OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H25ClO6S/c1-16(2,13-24-25(21,22)11-7-10-18)17(3,15(19)20)23-12-14-8-5-4-6-9-14/h4-6,8-9H,7,10-13H2,1-3H3,(H,19,20)/t17-/m0/s1 |
| InChIKey | IVRWCCRGTMTZIW-KRWDZBQOSA-N |
| XLogP | 3.05 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.90 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|