C22H33BO2 — CID 145174321
4,4,5,5-tetramethyl-2-[(2Z,4E,6E)-5-(2-methylprop-1-enyl)-6-[(Z)-prop-1-enyl]nona-2,4,6,8-tetraen-3-yl]-1,3,2-dioxaborolane (PubChem CID 145174321) has the molecular formula C22H33BO2 and a molecular weight of 340.32 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(2Z,4E,6E)-5-(2-methylprop-1-enyl)-6-[(Z)-prop-1-enyl]nona-2,4,6,8-tetraen-3-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(2Z,4E,6E)-5-(2-methylprop-1-enyl)-6-[(Z)-prop-1-enyl]nona-2,4,6,8-tetraen-3-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 145174321 |
| Molecular Formula | C22H33BO2 |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(2Z,4E,6E)-5-(2-methylprop-1-enyl)-6-[(Z)-prop-1-enyl]nona-2,4,6,8-tetraen-3-yl]-1,3,2-dioxaborolane |
| SMILES | C=C/C=C(\C=C/C)C(/C=C(C)C)=C/C(=C\C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H33BO2/c1-10-13-18(14-11-2)19(15-17(4)5)16-20(12-3)23-24-21(6,7)22(8,9)25-23/h10-16H,1H2,2-9H3/b14-11-,18-13+,19-16+,20-12+ |
| InChIKey | MJGOETJENDGBRV-ZCBKDQSWSA-N |
| XLogP | 6.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|