C15H29BN2O2 — CID 174004814
(Z)-N'-ethyl-N-methyl-N'-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]ethene-1,2-diamine (PubChem CID 174004814) has the molecular formula C15H29BN2O2 and a molecular weight of 280.22 g/mol. Its IUPAC name is (Z)-N'-ethyl-N-methyl-N'-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]ethene-1,2-diamine.
| Compound Name | (Z)-N'-ethyl-N-methyl-N'-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]ethene-1,2-diamine |
|---|---|
| PubChem CID | 174004814 |
| Molecular Formula | C15H29BN2O2 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.23 |
| IUPAC Name | (Z)-N'-ethyl-N-methyl-N'-[(Z)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-1-enyl]ethene-1,2-diamine |
| SMILES | CC/C(=C\N(/C=C\NC)CC)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H29BN2O2/c1-8-13(12-18(9-2)11-10-17-7)16-19-14(3,4)15(5,6)20-16/h10-12,17H,8-9H2,1-7H3/b11-10-,13-12+ |
| InChIKey | XYTDAOVDDLGXBN-JPYSRSMKSA-N |
| XLogP | 2.92 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|