C8H10ClN5 — CID 165375797
(Z)-3-amino-N-(4-chloropyrimidin-2-yl)-N'-methylprop-2-enimidamide (PubChem CID 165375797) has the molecular formula C8H10ClN5 and a molecular weight of 211.66 g/mol. Its IUPAC name is (Z)-3-amino-N-(4-chloropyrimidin-2-yl)-N'-methylprop-2-enimidamide.
| Compound Name | (Z)-3-amino-N-(4-chloropyrimidin-2-yl)-N'-methylprop-2-enimidamide |
|---|---|
| PubChem CID | 165375797 |
| Molecular Formula | C8H10ClN5 |
| Molecular Weight | 211.66 g/mol |
| Exact Mass | 211.06 |
| IUPAC Name | (Z)-3-amino-N-(4-chloropyrimidin-2-yl)-N'-methylprop-2-enimidamide |
| SMILES | C/N=C(/C=C\N)Nc1nccc(Cl)n1 |
| InChI | InChI=1S/C8H10ClN5/c1-11-7(2-4-10)14-8-12-5-3-6(9)13-8/h2-5H,10H2,1H3,(H,11,12,13,14)/b4-2- |
| InChIKey | PPMZTRUYUCRVMV-RQOWECAXSA-N |
| XLogP | 1.04 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.66 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|