C9H8ClN5 — CID 118237983
N-(4-chloropyrimidin-2-yl)-2-methylpyrimidin-4-amine (PubChem CID 118237983) has the molecular formula C9H8ClN5 and a molecular weight of 221.65 g/mol. Its IUPAC name is N-(4-chloropyrimidin-2-yl)-2-methylpyrimidin-4-amine.
| Compound Name | N-(4-chloropyrimidin-2-yl)-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 118237983 |
| Molecular Formula | C9H8ClN5 |
| Molecular Weight | 221.65 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | N-(4-chloropyrimidin-2-yl)-2-methylpyrimidin-4-amine |
| SMILES | Cc1nccc(Nc2nccc(Cl)n2)n1 |
| InChI | InChI=1S/C9H8ClN5/c1-6-11-5-3-8(13-6)15-9-12-4-2-7(10)14-9/h2-5H,1H3,(H,11,12,13,14,15) |
| InChIKey | RIUVUBSSIJLSIG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.65 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |