C12H13N3O — CID 91342021
N-(4-methoxyphenyl)-2-methylpyrimidin-4-amine (PubChem CID 91342021) has the molecular formula C12H13N3O and a molecular weight of 215.26 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-2-methylpyrimidin-4-amine.
| Compound Name | N-(4-methoxyphenyl)-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 91342021 |
| Molecular Formula | C12H13N3O |
| Molecular Weight | 215.26 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | N-(4-methoxyphenyl)-2-methylpyrimidin-4-amine |
| SMILES | COc1ccc(Nc2ccnc(C)n2)cc1 |
| InChI | InChI=1S/C12H13N3O/c1-9-13-8-7-12(14-9)15-10-3-5-11(16-2)6-4-10/h3-8H,1-2H3,(H,13,14,15) |
| InChIKey | HYAVFBZJTYLUKT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |