C10H10N2OS — CID 90956570
N-(4-methoxyphenyl)-1,3-thiazol-4-amine (PubChem CID 90956570) has the molecular formula C10H10N2OS and a molecular weight of 206.27 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-1,3-thiazol-4-amine.
| Compound Name | N-(4-methoxyphenyl)-1,3-thiazol-4-amine |
|---|---|
| PubChem CID | 90956570 |
| Molecular Formula | C10H10N2OS |
| Molecular Weight | 206.27 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | N-(4-methoxyphenyl)-1,3-thiazol-4-amine |
| SMILES | COc1ccc(Nc2cscn2)cc1 |
| InChI | InChI=1S/C10H10N2OS/c1-13-9-4-2-8(3-5-9)12-10-6-14-7-11-10/h2-7,12H,1H3 |
| InChIKey | MXAJIVDMECMQMD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |