C10H12BrN2OS- — CID 21179407
N-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-2-amine bromide (PubChem CID 21179407) has the molecular formula C10H12BrN2OS- and a molecular weight of 288.19 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-2-amine bromide.
| Compound Name | N-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-2-amine bromide |
|---|---|
| PubChem CID | 21179407 |
| Molecular Formula | C10H12BrN2OS- |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 286.99 |
| IUPAC Name | N-(4-methoxyphenyl)-4,5-dihydro-1,3-thiazol-2-amine bromide |
| SMILES | COc1ccc(NC2=NCCS2)cc1.[Br-] |
| InChI | InChI=1S/C10H12N2OS.BrH/c1-13-9-4-2-8(3-5-9)12-10-11-6-7-14-10;/h2-5H,6-7H2,1H3,(H,11,12);1H/p-1 |
| InChIKey | SKFAPAVESWMNKH-UHFFFAOYSA-M |
| XLogP | -0.79 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |