C12H16N2OS — CID 2345498
N-(4-ethoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine (PubChem CID 2345498) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine.
| Compound Name | N-(4-ethoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
|---|---|
| PubChem CID | 2345498 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | N-(4-ethoxyphenyl)-5,6-dihydro-4H-1,3-thiazin-2-amine |
| SMILES | CCOc1ccc(NC2=NCCCS2)cc1 |
| InChI | InChI=1S/C12H16N2OS/c1-2-15-11-6-4-10(5-7-11)14-12-13-8-3-9-16-12/h4-7H,2-3,8-9H2,1H3,(H,13,14) |
| InChIKey | GUTMGLXKZQVYEY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |