C23H26N2O3S — CID 8685780
(E)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]-3-(4-methoxy-3-propoxyphenyl)prop-2-en-1-one (PubChem CID 8685780) has the molecular formula C23H26N2O3S and a molecular weight of 410.54 g/mol. Its IUPAC name is (E)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]-3-(4-methoxy-3-propoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]-3-(4-methoxy-3-propoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8685780 |
| Molecular Formula | C23H26N2O3S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | (E)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]-3-(4-methoxy-3-propoxyphenyl)prop-2-en-1-one |
| SMILES | CCCOc1cc(/C=C/C(=O)c2ccc(NC3=NCCCS3)cc2)ccc1OC |
| InChI | InChI=1S/C23H26N2O3S/c1-3-14-28-22-16-17(6-12-21(22)27-2)5-11-20(26)18-7-9-19(10-8-18)25-23-24-13-4-15-29-23/h5-12,16H,3-4,13-15H2,1-2H3,(H,24,25)/b11-5+ |
| InChIKey | WLYJDCDZBOTPLS-VZUCSPMQSA-N |
| XLogP | 5.28 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|