C21H22N2OS — CID 8685723
(E)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]-3-(2,4-dimethylphenyl)prop-2-en-1-one (PubChem CID 8685723) has the molecular formula C21H22N2OS and a molecular weight of 350.49 g/mol. Its IUPAC name is (E)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]-3-(2,4-dimethylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]-3-(2,4-dimethylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 8685723 |
| Molecular Formula | C21H22N2OS |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (E)-1-[4-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)phenyl]-3-(2,4-dimethylphenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(/C=C/C(=O)c2ccc(NC3=NCCCS3)cc2)c(C)c1 |
| InChI | InChI=1S/C21H22N2OS/c1-15-4-5-17(16(2)14-15)8-11-20(24)18-6-9-19(10-7-18)23-21-22-12-3-13-25-21/h4-11,14H,3,12-13H2,1-2H3,(H,22,23)/b11-8+ |
| InChIKey | QIVLPVUZPTYWEB-DHZHZOJOSA-N |
| XLogP | 5.10 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|