C17H15IO — CID 5186975
3-(2,5-dimethylphenyl)-1-(4-iodophenyl)prop-2-en-1-one (PubChem CID 5186975) has the molecular formula C17H15IO and a molecular weight of 362.21 g/mol. Its IUPAC name is 3-(2,5-dimethylphenyl)-1-(4-iodophenyl)prop-2-en-1-one.
| Compound Name | 3-(2,5-dimethylphenyl)-1-(4-iodophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5186975 |
| Molecular Formula | C17H15IO |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 3-(2,5-dimethylphenyl)-1-(4-iodophenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(C)c(C=CC(=O)c2ccc(I)cc2)c1 |
| InChI | InChI=1S/C17H15IO/c1-12-3-4-13(2)15(11-12)7-10-17(19)14-5-8-16(18)9-6-14/h3-11H,1-2H3 |
| InChIKey | WDYZJVHSVQGGNH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|