C16H11Cl3O — CID 91586373
1-(4-methylphenyl)-3-(2,3,5-trichlorophenyl)prop-2-en-1-one (PubChem CID 91586373) has the molecular formula C16H11Cl3O and a molecular weight of 325.62 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(2,3,5-trichlorophenyl)prop-2-en-1-one.
| Compound Name | 1-(4-methylphenyl)-3-(2,3,5-trichlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 91586373 |
| Molecular Formula | C16H11Cl3O |
| Molecular Weight | 325.62 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 1-(4-methylphenyl)-3-(2,3,5-trichlorophenyl)prop-2-en-1-one |
| SMILES | Cc1ccc(C(=O)C=Cc2cc(Cl)cc(Cl)c2Cl)cc1 |
| InChI | InChI=1S/C16H11Cl3O/c1-10-2-4-11(5-3-10)15(20)7-6-12-8-13(17)9-14(18)16(12)19/h2-9H,1H3 |
| InChIKey | ZHNQSERABAIYLQ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.62 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|