C11H11O2- — CID 7019631
(E)-3-(2,5-dimethylphenyl)prop-2-enoate (PubChem CID 7019631) has the molecular formula C11H11O2- and a molecular weight of 175.21 g/mol. Its IUPAC name is (E)-3-(2,5-dimethylphenyl)prop-2-enoate.
| Compound Name | (E)-3-(2,5-dimethylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7019631 |
| Molecular Formula | C11H11O2- |
| Molecular Weight | 175.21 g/mol |
| Exact Mass | 175.08 |
| IUPAC Name | (E)-3-(2,5-dimethylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(C)c(/C=C/C(=O)[O-])c1 |
| InChI | InChI=1S/C11H12O2/c1-8-3-4-9(2)10(7-8)5-6-11(12)13/h3-7H,1-2H3,(H,12,13)/p-1/b6-5+ |
| InChIKey | FAIBVLSPNAHVSQ-AATRIKPKSA-M |
| XLogP | 1.07 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|