C10H10NO2- — CID 23157274
(E)-3-(4-amino-2-methylphenyl)prop-2-enoate (PubChem CID 23157274) has the molecular formula C10H10NO2- and a molecular weight of 176.19 g/mol. Its IUPAC name is (E)-3-(4-amino-2-methylphenyl)prop-2-enoate.
| Compound Name | (E)-3-(4-amino-2-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 23157274 |
| Molecular Formula | C10H10NO2- |
| Molecular Weight | 176.19 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | (E)-3-(4-amino-2-methylphenyl)prop-2-enoate |
| SMILES | Cc1cc(N)ccc1/C=C/C(=O)[O-] |
| InChI | InChI=1S/C10H11NO2/c1-7-6-9(11)4-2-8(7)3-5-10(12)13/h2-6H,11H2,1H3,(H,12,13)/p-1/b5-3+ |
| InChIKey | AEPKGTYUARTIMM-HWKANZROSA-M |
| XLogP | 0.34 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.19 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|