C12H18S — CID 143503562
(Z)-2-(2,5-dimethylphenyl)ethenethiol;ethane (PubChem CID 143503562) has the molecular formula C12H18S and a molecular weight of 194.34 g/mol. Its IUPAC name is (Z)-2-(2,5-dimethylphenyl)ethenethiol;ethane.
| Compound Name | (Z)-2-(2,5-dimethylphenyl)ethenethiol;ethane |
|---|---|
| PubChem CID | 143503562 |
| Molecular Formula | C12H18S |
| Molecular Weight | 194.34 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | (Z)-2-(2,5-dimethylphenyl)ethenethiol;ethane |
| SMILES | CC.Cc1ccc(C)c(/C=C\S)c1 |
| InChI | InChI=1S/C10H12S.C2H6/c1-8-3-4-9(2)10(7-8)5-6-11;1-2/h3-7,11H,1-2H3;1-2H3/b6-5-; |
| InChIKey | DHTPDCNCFKATPW-YSMBQZINSA-N |
| XLogP | 4.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.34 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|