C12H13N — CID 83695516
(E)-4-(2,5-dimethylphenyl)but-3-enenitrile (PubChem CID 83695516) has the molecular formula C12H13N and a molecular weight of 171.24 g/mol. Its IUPAC name is (E)-4-(2,5-dimethylphenyl)but-3-enenitrile.
| Compound Name | (E)-4-(2,5-dimethylphenyl)but-3-enenitrile |
|---|---|
| PubChem CID | 83695516 |
| Molecular Formula | C12H13N |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | (E)-4-(2,5-dimethylphenyl)but-3-enenitrile |
| SMILES | Cc1ccc(C)c(/C=C/CC#N)c1 |
| InChI | InChI=1S/C12H13N/c1-10-6-7-11(2)12(9-10)5-3-4-8-13/h3,5-7,9H,4H2,1-2H3/b5-3+ |
| InChIKey | IXIIVGDSTYRJFG-HWKANZROSA-N |
| XLogP | 3.23 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |