About chloro-[3-(2,5-dimethylphenyl)prop-2-enyl]silane
chloro-[3-(2,5-dimethylphenyl)prop-2-enyl]silane (PubChem CID 152755500) has the molecular formula C11H15ClSi
and a molecular weight of 210.78 g/mol. Its IUPAC name is chloro-[3-(2,5-dimethylphenyl)prop-2-enyl]silane.
Molecular Properties
| Compound Name | chloro-[3-(2,5-dimethylphenyl)prop-2-enyl]silane |
| PubChem CID | 152755500 |
| Molecular Formula | C11H15ClSi |
| Molecular Weight | 210.78 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | chloro-[3-(2,5-dimethylphenyl)prop-2-enyl]silane |
| SMILES | Cc1ccc(C)c(C=CC[SiH2]Cl)c1 |
| InChI | InChI=1S/C11H15ClSi/c1-9-5-6-10(2)11(8-9)4-3-7-13-12/h3-6,8H,7,13H2,1-2H3 |
| InChIKey | LDUKHAFWRWAWRT-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.78 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro-[3-(2,5-dimethylphenyl)prop-2-enyl]silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro-[3-(2,5-dimethylphenyl)prop-2-enyl]silane?
The IUPAC name of chloro-[3-(2,5-dimethylphenyl)prop-2-enyl]silane (CID 152755500) is chloro-[3-(2,5-dimethylphenyl)prop-2-enyl]silane.
What is the SMILES notation for chloro-[3-(2,5-dimethylphenyl)prop-2-enyl]silane?
The canonical SMILES for chloro-[3-(2,5-dimethylphenyl)prop-2-enyl]silane is Cc1ccc(C)c(C=CC[SiH2]Cl)c1.
What is the InChIKey of chloro-[3-(2,5-dimethylphenyl)prop-2-enyl]silane?
The InChIKey is LDUKHAFWRWAWRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15ClSi/c1-9-5-6-10(2)11(8-9)4-3-7-13-12/h3-6,8H,7,13H2,1-2H3.
What are the key properties of chloro-[3-(2,5-dimethylphenyl)prop-2-enyl]silane?
chloro-[3-(2,5-dimethylphenyl)prop-2-enyl]silane has a molecular weight of 210.78 g/mol, XLogP of 3.06, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro-[3-(2,5-dimethylphenyl)prop-2-enyl]silane is sourced from PubChem (CID 152755500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).