C22H23N3O3S — CID 54168321
3-[4-[[3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)benzoyl]amino]-3,5-dimethylphenyl]prop-2-enoic acid (PubChem CID 54168321) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is 3-[4-[[3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)benzoyl]amino]-3,5-dimethylphenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[[3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)benzoyl]amino]-3,5-dimethylphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54168321 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 3-[4-[[3-(5,6-dihydro-4H-1,3-thiazin-2-ylamino)benzoyl]amino]-3,5-dimethylphenyl]prop-2-enoic acid |
| SMILES | Cc1cc(C=CC(=O)O)cc(C)c1NC(=O)c1cccc(NC2=NCCCS2)c1 |
| InChI | InChI=1S/C22H23N3O3S/c1-14-11-16(7-8-19(26)27)12-15(2)20(14)25-21(28)17-5-3-6-18(13-17)24-22-23-9-4-10-29-22/h3,5-8,11-13H,4,9-10H2,1-2H3,(H,23,24)(H,25,28)(H,26,27) |
| InChIKey | OTFVELVRWVPHOT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|